C10H15N4P — CID 156710909
(8-methyl-4-propan-2-ylpyridazino[6,1-c][1,2,4]triazin-8-yl)phosphane (PubChem CID 156710909) has the molecular formula C10H15N4P and a molecular weight of 222.23 g/mol. Its IUPAC name is (8-methyl-4-propan-2-ylpyridazino[6,1-c][1,2,4]triazin-8-yl)phosphane.
| Compound Name | (8-methyl-4-propan-2-ylpyridazino[6,1-c][1,2,4]triazin-8-yl)phosphane |
|---|---|
| PubChem CID | 156710909 |
| Molecular Formula | C10H15N4P |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (8-methyl-4-propan-2-ylpyridazino[6,1-c][1,2,4]triazin-8-yl)phosphane |
| SMILES | CC(C)C1=CN=NC2=CC(C)(P)C=NN21 |
| InChI | InChI=1S/C10H15N4P/c1-7(2)8-5-11-13-9-4-10(3,15)6-12-14(8)9/h4-7H,15H2,1-3H3 |
| InChIKey | OSCAOTGNFGSHGM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|