About 7-ethyltetrazolo[1,5-a][1,3,5]triazine
7-ethyltetrazolo[1,5-a][1,3,5]triazine (PubChem CID 156710931) has the molecular formula C5H6N6
and a molecular weight of 150.15 g/mol. Its IUPAC name is 7-ethyltetrazolo[1,5-a][1,3,5]triazine.
Molecular Properties
| Compound Name | 7-ethyltetrazolo[1,5-a][1,3,5]triazine |
| PubChem CID | 156710931 |
| Molecular Formula | C5H6N6 |
| Molecular Weight | 150.15 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 7-ethyltetrazolo[1,5-a][1,3,5]triazine |
| SMILES | CCc1ncnc2nnnn12 |
| InChI | InChI=1S/C5H6N6/c1-2-4-6-3-7-5-8-9-10-11(4)5/h3H,2H2,1H3 |
| InChIKey | LAADGTVECKZBMJ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 68.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.15 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-ethyltetrazolo[1,5-a][1,3,5]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyltetrazolo[1,5-a][1,3,5]triazine?
The IUPAC name of 7-ethyltetrazolo[1,5-a][1,3,5]triazine (CID 156710931) is 7-ethyltetrazolo[1,5-a][1,3,5]triazine.
What is the SMILES notation for 7-ethyltetrazolo[1,5-a][1,3,5]triazine?
The canonical SMILES for 7-ethyltetrazolo[1,5-a][1,3,5]triazine is CCc1ncnc2nnnn12.
What is the InChIKey of 7-ethyltetrazolo[1,5-a][1,3,5]triazine?
The InChIKey is LAADGTVECKZBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N6/c1-2-4-6-3-7-5-8-9-10-11(4)5/h3H,2H2,1H3.
What are the key properties of 7-ethyltetrazolo[1,5-a][1,3,5]triazine?
7-ethyltetrazolo[1,5-a][1,3,5]triazine has a molecular weight of 150.15 g/mol, XLogP of -0.52, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyltetrazolo[1,5-a][1,3,5]triazine is sourced from PubChem (CID 156710931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).