C15H14F3N6O5+ — CID 156710956
methyl 2,2,2-trifluoroacetate;3-[4-(4-oxo-6H-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)pyridin-1-ium-1-yl]propanoic acid (PubChem CID 156710956) has the molecular formula C15H14F3N6O5+ and a molecular weight of 415.31 g/mol. Its IUPAC name is methyl 2,2,2-trifluoroacetate;3-[4-(4-oxo-6H-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)pyridin-1-ium-1-yl]propanoic acid.
| Compound Name | methyl 2,2,2-trifluoroacetate;3-[4-(4-oxo-6H-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)pyridin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 156710956 |
| Molecular Formula | C15H14F3N6O5+ |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | methyl 2,2,2-trifluoroacetate;3-[4-(4-oxo-6H-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)pyridin-1-ium-1-yl]propanoic acid |
| SMILES | COC(=O)C(F)(F)F.O=C(O)CC[n+]1ccc(-c2nnc3nc[nH]n3c2=O)cc1 |
| InChI | InChI=1S/C12H10N6O3.C3H3F3O2/c19-9(20)3-6-17-4-1-8(2-5-17)10-11(21)18-12(16-15-10)13-7-14-18;1-8-2(7)3(4,5)6/h1-2,4-5,7H,3,6H2,(H,19,20);1H3/p+1 |
| InChIKey | XSTSRAOOOFXVEU-UHFFFAOYSA-O |
| XLogP | -0.04 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|