C15H14F3N6O4+ — CID 156710983
methyl 2,2,2-trifluoroacetate;3-[4-([1,2,4]triazolo[4,3-b][1,2,4]triazin-7-yl)pyridin-1-ium-1-yl]propanoic acid (PubChem CID 156710983) has the molecular formula C15H14F3N6O4+ and a molecular weight of 399.31 g/mol. Its IUPAC name is methyl 2,2,2-trifluoroacetate;3-[4-([1,2,4]triazolo[4,3-b][1,2,4]triazin-7-yl)pyridin-1-ium-1-yl]propanoic acid.
| Compound Name | methyl 2,2,2-trifluoroacetate;3-[4-([1,2,4]triazolo[4,3-b][1,2,4]triazin-7-yl)pyridin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 156710983 |
| Molecular Formula | C15H14F3N6O4+ |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | methyl 2,2,2-trifluoroacetate;3-[4-([1,2,4]triazolo[4,3-b][1,2,4]triazin-7-yl)pyridin-1-ium-1-yl]propanoic acid |
| SMILES | COC(=O)C(F)(F)F.O=C(O)CC[n+]1ccc(-c2cnn3cnnc3n2)cc1 |
| InChI | InChI=1S/C12H10N6O2.C3H3F3O2/c19-11(20)3-6-17-4-1-9(2-5-17)10-7-14-18-8-13-16-12(18)15-10;1-8-2(7)3(4,5)6/h1-2,4-5,7-8H,3,6H2;1H3/p+1 |
| InChIKey | WBXSDLIBJXWMSL-UHFFFAOYSA-O |
| XLogP | 0.67 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|