C32H30F6S2Si — CID 156711255
triethyl-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophen-2-yl]silane (PubChem CID 156711255) has the molecular formula C32H30F6S2Si and a molecular weight of 620.80 g/mol. Its IUPAC name is triethyl-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophen-2-yl]silane.
| Compound Name | triethyl-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophen-2-yl]silane |
|---|---|
| PubChem CID | 156711255 |
| Molecular Formula | C32H30F6S2Si |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | triethyl-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-5-phenylthiophen-2-yl]silane |
| SMILES | CC[Si](CC)(CC)c1sc(-c2ccccc2)cc1C1=C(c2cc(-c3ccccc3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C32H30F6S2Si/c1-5-41(6-2,7-3)29-24(19-26(40-29)22-16-12-9-13-17-22)28-27(30(33,34)32(37,38)31(28,35)36)23-18-25(39-20(23)4)21-14-10-8-11-15-21/h8-19H,5-7H2,1-4H3 |
| InChIKey | RWCUVUBVHJKDAC-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.80 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|