C23H23NO5S — CID 15671166
5-[[4-[(2,5,7-trimethyl-4-oxo-3H-chromen-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 15671166) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is 5-[[4-[(2,5,7-trimethyl-4-oxo-3H-chromen-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(2,5,7-trimethyl-4-oxo-3H-chromen-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 15671166 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 5-[[4-[(2,5,7-trimethyl-4-oxo-3H-chromen-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(C)c2c(c1)OC(C)(COc1ccc(CC3SC(=O)NC3=O)cc1)CC2=O |
| InChI | InChI=1S/C23H23NO5S/c1-13-8-14(2)20-17(25)11-23(3,29-18(20)9-13)12-28-16-6-4-15(5-7-16)10-19-21(26)24-22(27)30-19/h4-9,19H,10-12H2,1-3H3,(H,24,26,27) |
| InChIKey | JMUOZTSRWJYUPX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|