C16H18Cl2N4OS — CID 156711746
2-(3,6-diazabicyclo[3.2.0]heptan-6-yl)-2-[(E)-2-(2,3-dichlorophenyl)sulfanyl-2-(methylamino)ethenyl]iminoacetaldehyde (PubChem CID 156711746) has the molecular formula C16H18Cl2N4OS and a molecular weight of 385.32 g/mol. Its IUPAC name is 2-(3,6-diazabicyclo[3.2.0]heptan-6-yl)-2-[(E)-2-(2,3-dichlorophenyl)sulfanyl-2-(methylamino)ethenyl]iminoacetaldehyde.
| Compound Name | 2-(3,6-diazabicyclo[3.2.0]heptan-6-yl)-2-[(E)-2-(2,3-dichlorophenyl)sulfanyl-2-(methylamino)ethenyl]iminoacetaldehyde |
|---|---|
| PubChem CID | 156711746 |
| Molecular Formula | C16H18Cl2N4OS |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-(3,6-diazabicyclo[3.2.0]heptan-6-yl)-2-[(E)-2-(2,3-dichlorophenyl)sulfanyl-2-(methylamino)ethenyl]iminoacetaldehyde |
| SMILES | CN/C(=C\N=C(/C=O)N1CC2CNCC21)Sc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H18Cl2N4OS/c1-19-15(24-13-4-2-3-11(17)16(13)18)7-21-14(9-23)22-8-10-5-20-6-12(10)22/h2-4,7,9-10,12,19-20H,5-6,8H2,1H3/b15-7+,21-14+ |
| InChIKey | RQJFBIZSJDFAOV-KOFBEHCASA-N |
| XLogP | 2.60 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|