C14H20ClN3 — CID 156712040
2-chloro-4-(2-methylpiperazin-1-yl)benzonitrile;ethane (PubChem CID 156712040) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 2-chloro-4-(2-methylpiperazin-1-yl)benzonitrile;ethane.
| Compound Name | 2-chloro-4-(2-methylpiperazin-1-yl)benzonitrile;ethane |
|---|---|
| PubChem CID | 156712040 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-chloro-4-(2-methylpiperazin-1-yl)benzonitrile;ethane |
| SMILES | CC.CC1CNCCN1c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClN3.C2H6/c1-9-8-15-4-5-16(9)11-3-2-10(7-14)12(13)6-11;1-2/h2-3,6,9,15H,4-5,8H2,1H3;1-2H3 |
| InChIKey | LTCPWMKGKAKJQA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |