About cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane
cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane (PubChem CID 156712524) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane.
Molecular Properties
| Compound Name | cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane |
| PubChem CID | 156712524 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane |
| SMILES | CN1CC2(COC2)C1.NC1CCCCC1 |
| InChI | InChI=1S/C6H11NO.C6H13N/c1-7-2-6(3-7)4-8-5-6;7-6-4-2-1-3-5-6/h2-5H2,1H3;6H,1-5,7H2 |
| InChIKey | JQGJLYXEEJYSCE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane?
The IUPAC name of cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane (CID 156712524) is cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane.
What is the SMILES notation for cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane?
The canonical SMILES for cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane is CN1CC2(COC2)C1.NC1CCCCC1.
What is the InChIKey of cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane?
The InChIKey is JQGJLYXEEJYSCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C6H13N/c1-7-2-6(3-7)4-8-5-6;7-6-4-2-1-3-5-6/h2-5H2,1H3;6H,1-5,7H2.
What are the key properties of cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane?
cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane has a molecular weight of 212.34 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;6-methyl-2-oxa-6-azaspiro[3.3]heptane is sourced from PubChem (CID 156712524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).