C31H42F3N5O4 — CID 156712859
formamide;methanol;3-[4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propan-1-ol (PubChem CID 156712859) has the molecular formula C31H42F3N5O4 and a molecular weight of 605.70 g/mol. Its IUPAC name is formamide;methanol;3-[4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propan-1-ol.
| Compound Name | formamide;methanol;3-[4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 156712859 |
| Molecular Formula | C31H42F3N5O4 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.32 |
| IUPAC Name | formamide;methanol;3-[4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propan-1-ol |
| SMILES | CO.COc1cc(C)ccc1NCC#Cc1cc2c(NC3CCN(CCCO)CC3)cccc2n1CC(F)(F)F.NC=O |
| InChI | InChI=1S/C29H35F3N4O2.CH3NO.CH4O/c1-21-9-10-26(28(18-21)38-2)33-13-4-6-23-19-24-25(7-3-8-27(24)36(23)20-29(30,31)32)34-22-11-15-35(16-12-22)14-5-17-37;2-1-3;1-2/h3,7-10,18-19,22,33-34,37H,5,11-17,20H2,1-2H3;1H,(H2,2,3);2H,1H3 |
| InChIKey | GULGMIJIMZTMCT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|