C29H34F4N4O4 — CID 156713064
2-[3-fluoro-4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethanol;formic acid (PubChem CID 156713064) has the molecular formula C29H34F4N4O4 and a molecular weight of 578.61 g/mol. Its IUPAC name is 2-[3-fluoro-4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethanol;formic acid.
| Compound Name | 2-[3-fluoro-4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethanol;formic acid |
|---|---|
| PubChem CID | 156713064 |
| Molecular Formula | C29H34F4N4O4 |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 2-[3-fluoro-4-[[2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethanol;formic acid |
| SMILES | COc1cc(C)ccc1NCC#Cc1cc2c(NC3CCN(CCO)CC3F)cccc2n1CC(F)(F)F.O=CO |
| InChI | InChI=1S/C28H32F4N4O2.CH2O2/c1-19-8-9-25(27(15-19)38-2)33-11-4-5-20-16-21-23(6-3-7-26(21)36(20)18-28(30,31)32)34-24-10-12-35(13-14-37)17-22(24)29;2-1-3/h3,6-9,15-16,22,24,33-34,37H,10-14,17-18H2,1-2H3;1H,(H,2,3) |
| InChIKey | OHCCDDXIXCWNDI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|