About 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane
5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane (PubChem CID 156713123) has the molecular formula C14H18FNO2
and a molecular weight of 251.30 g/mol. Its IUPAC name is 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane.
Molecular Properties
| Compound Name | 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane |
| PubChem CID | 156713123 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane |
| SMILES | CC(C)c1cc2c(cc1F)C(=O)NC2=O.CCC |
| InChI | InChI=1S/C11H10FNO2.C3H8/c1-5(2)6-3-7-8(4-9(6)12)11(15)13-10(7)14;1-3-2/h3-5H,1-2H3,(H,13,14,15);3H2,1-2H3 |
| InChIKey | BLWVVFBTQPNJCX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane?
The IUPAC name of 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane (CID 156713123) is 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane.
What is the SMILES notation for 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane?
The canonical SMILES for 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane is CC(C)c1cc2c(cc1F)C(=O)NC2=O.CCC.
What is the InChIKey of 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane?
The InChIKey is BLWVVFBTQPNJCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO2.C3H8/c1-5(2)6-3-7-8(4-9(6)12)11(15)13-10(7)14;1-3-2/h3-5H,1-2H3,(H,13,14,15);3H2,1-2H3.
What are the key properties of 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane?
5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane has a molecular weight of 251.30 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-propan-2-ylisoindole-1,3-dione;propane is sourced from PubChem (CID 156713123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).