About (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol
(4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol (PubChem CID 156713536) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol.
Molecular Properties
| Compound Name | (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol |
| PubChem CID | 156713536 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol |
| SMILES | CCc1c(CO)cnc2nc(OC)ccc12 |
| InChI | InChI=1S/C12H14N2O2/c1-3-9-8(7-15)6-13-12-10(9)4-5-11(14-12)16-2/h4-6,15H,3,7H2,1-2H3 |
| InChIKey | LQHXYOCGVLGVKP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol?
The IUPAC name of (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol (CID 156713536) is (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol.
What is the SMILES notation for (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol?
The canonical SMILES for (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol is CCc1c(CO)cnc2nc(OC)ccc12.
What is the InChIKey of (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol?
The InChIKey is LQHXYOCGVLGVKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-3-9-8(7-15)6-13-12-10(9)4-5-11(14-12)16-2/h4-6,15H,3,7H2,1-2H3.
What are the key properties of (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol?
(4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol has a molecular weight of 218.26 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-7-methoxy-1,8-naphthyridin-3-yl)methanol is sourced from PubChem (CID 156713536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).