C32H46BN3O2Si — CID 156713598
CID 156713598 (PubChem CID 156713598) has the molecular formula C32H46BN3O2Si and a molecular weight of 543.64 g/mol.
| Compound Name | CID 156713598 |
|---|---|
| PubChem CID | 156713598 |
| Molecular Formula | C32H46BN3O2Si |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.35 |
| IUPAC Name | — |
| SMILES | CC1C2(CCN(Cc3ccccc3)CC2)CC12OB(O)c1cnc3c(ccn3[Si](C(C)C)(C(C)C)C(C)C)c12 |
| InChI | InChI=1S/C32H46BN3O2Si/c1-22(2)39(23(3)4,24(5)6)36-16-13-27-29-28(19-34-30(27)36)33(37)38-32(29)21-31(25(32)7)14-17-35(18-15-31)20-26-11-9-8-10-12-26/h8-13,16,19,22-25,37H,14-15,17-18,20-21H2,1-7H3 |
| InChIKey | IPGWVSUUEHCHPB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|