C14H18BN3O4S — CID 156713759
1'-ethylsulfonyl-5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine] (PubChem CID 156713759) has the molecular formula C14H18BN3O4S and a molecular weight of 335.19 g/mol. Its IUPAC name is 1'-ethylsulfonyl-5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine].
| Compound Name | 1'-ethylsulfonyl-5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine] |
|---|---|
| PubChem CID | 156713759 |
| Molecular Formula | C14H18BN3O4S |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1'-ethylsulfonyl-5-hydroxyspiro[4-oxa-8,10-diaza-5-boratricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene-3,4'-piperidine] |
| SMILES | CCS(=O)(=O)N1CCC2(CC1)OB(O)c1cnc3[nH]ccc3c12 |
| InChI | InChI=1S/C14H18BN3O4S/c1-2-23(20,21)18-7-4-14(5-8-18)12-10-3-6-16-13(10)17-9-11(12)15(19)22-14/h3,6,9,19H,2,4-5,7-8H2,1H3,(H,16,17) |
| InChIKey | XIINUDNVAHBXGF-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|