C76H98N16O8 — CID 156714240
3,7-dimethyl-1-octyl-8-[3,6,8-tris(3,7-dimethyl-1-octyl-2,6-dioxopurin-8-yl)pyren-1-yl]purine-2,6-dione (PubChem CID 156714240) has the molecular formula C76H98N16O8 and a molecular weight of 1363.72 g/mol. Its IUPAC name is 3,7-dimethyl-1-octyl-8-[3,6,8-tris(3,7-dimethyl-1-octyl-2,6-dioxopurin-8-yl)pyren-1-yl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-octyl-8-[3,6,8-tris(3,7-dimethyl-1-octyl-2,6-dioxopurin-8-yl)pyren-1-yl]purine-2,6-dione |
|---|---|
| PubChem CID | 156714240 |
| Molecular Formula | C76H98N16O8 |
| Molecular Weight | 1363.72 g/mol |
| Exact Mass | 1362.78 |
| IUPAC Name | 3,7-dimethyl-1-octyl-8-[3,6,8-tris(3,7-dimethyl-1-octyl-2,6-dioxopurin-8-yl)pyren-1-yl]purine-2,6-dione |
| SMILES | CCCCCCCCn1c(=O)c2c(nc(-c3cc(-c4nc5c(c(=O)n(CCCCCCCC)c(=O)n5C)n4C)c4ccc5c(-c6nc7c(c(=O)n(CCCCCCCC)c(=O)n7C)n6C)cc(-c6nc7c(c(=O)n(CCCCCCCC)c(=O)n7C)n6C)c6ccc3c4c65)n2C)n(C)c1=O |
| InChI | InChI=1S/C76H98N16O8/c1-13-17-21-25-29-33-41-89-69(93)57-65(85(9)73(89)97)77-61(81(57)5)51-45-52(62-78-66-58(82(62)6)70(94)90(74(98)86(66)10)42-34-30-26-22-18-14-2)48-39-40-50-54(64-80-68-60(84(64)8)72(96)92(76(100)88(68)12)44-36-32-28-24-20-16-4)46-53(49-38-37-47(51)55(48)56(49)50)63-79-67-59(83(63)7)71(95)91(75(99)87(67)11)43-35-31-27-23-19-15-3/h37-40,45-46H,13-36,41-44H2,1-12H3 |
| InChIKey | NKFDSNPIFVFZOR-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 247.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 100 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1363.72 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|