About [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite
[8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite (PubChem CID 156714328) has the molecular formula C17H9Cl2FN4O2S
and a molecular weight of 423.26 g/mol. Its IUPAC name is [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite |
| PubChem CID | 156714328 |
| Molecular Formula | C17H9Cl2FN4O2S |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite |
| SMILES | O=c1[nH]c(=O)n(SF)c2nc(-c3ccccc3Cl)n(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C17H9Cl2FN4O2S/c18-9-5-7-10(8-6-9)23-13-15(24(27-20)17(26)22-16(13)25)21-14(23)11-3-1-2-4-12(11)19/h1-8H,(H,22,25,26) |
| InChIKey | XTEKDPILLFTGBI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite?
The IUPAC name of [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite (CID 156714328) is [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite.
What is the SMILES notation for [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite?
The canonical SMILES for [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite is O=c1[nH]c(=O)n(SF)c2nc(-c3ccccc3Cl)n(-c3ccc(Cl)cc3)c12.
What is the InChIKey of [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite?
The InChIKey is XTEKDPILLFTGBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9Cl2FN4O2S/c18-9-5-7-10(8-6-9)23-13-15(24(27-20)17(26)22-16(13)25)21-14(23)11-3-1-2-4-12(11)19/h1-8H,(H,22,25,26).
What are the key properties of [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite?
[8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite has a molecular weight of 423.26 g/mol, XLogP of 4.23, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(2-chlorophenyl)-7-(4-chlorophenyl)-2,6-dioxopurin-3-yl] thiohypofluorite is sourced from PubChem (CID 156714328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).