About N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine
N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine (PubChem CID 156714532) has the molecular formula C16H35NO
and a molecular weight of 257.46 g/mol. Its IUPAC name is N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine |
| PubChem CID | 156714532 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine |
| SMILES | CC(C)(C)COC(C)(C)CC(C)(C)NC(C)(C)C |
| InChI | InChI=1S/C16H35NO/c1-13(2,3)12-18-16(9,10)11-15(7,8)17-14(4,5)6/h17H,11-12H2,1-10H3 |
| InChIKey | SEJRGHIOQWGYLL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine?
The IUPAC name of N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine (CID 156714532) is N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine.
What is the SMILES notation for N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine?
The canonical SMILES for N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine is CC(C)(C)COC(C)(C)CC(C)(C)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine?
The InChIKey is SEJRGHIOQWGYLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35NO/c1-13(2,3)12-18-16(9,10)11-15(7,8)17-14(4,5)6/h17H,11-12H2,1-10H3.
What are the key properties of N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine?
N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine has a molecular weight of 257.46 g/mol, XLogP of 4.38, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4-(2,2-dimethylpropoxy)-2,4-dimethylpentan-2-amine is sourced from PubChem (CID 156714532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).