C19H20F2N4O — CID 156715005
1-[3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-4-[(4-methylpyrazol-1-yl)methyl]pent-4-en-1-one (PubChem CID 156715005) has the molecular formula C19H20F2N4O and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-[3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-4-[(4-methylpyrazol-1-yl)methyl]pent-4-en-1-one.
| Compound Name | 1-[3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-4-[(4-methylpyrazol-1-yl)methyl]pent-4-en-1-one |
|---|---|
| PubChem CID | 156715005 |
| Molecular Formula | C19H20F2N4O |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-4-[(4-methylpyrazol-1-yl)methyl]pent-4-en-1-one |
| SMILES | C=C(CCC(=O)N1N=CCC1c1cc(F)cc(F)c1)Cn1cc(C)cn1 |
| InChI | InChI=1S/C19H20F2N4O/c1-13(11-24-12-14(2)10-23-24)3-4-19(26)25-18(5-6-22-25)15-7-16(20)9-17(21)8-15/h6-10,12,18H,1,3-5,11H2,2H3 |
| InChIKey | BKCZDXGFBNFHHY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|