C6H8FNO — CID 156715081
(1E,3E,5E)-4-amino-6-fluorohexa-1,3,5-trien-1-ol (PubChem CID 156715081) has the molecular formula C6H8FNO and a molecular weight of 129.13 g/mol. Its IUPAC name is (1E,3E,5E)-4-amino-6-fluorohexa-1,3,5-trien-1-ol.
| Compound Name | (1E,3E,5E)-4-amino-6-fluorohexa-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 156715081 |
| Molecular Formula | C6H8FNO |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | (1E,3E,5E)-4-amino-6-fluorohexa-1,3,5-trien-1-ol |
| SMILES | NC(/C=C/F)=C/C=C/O |
| InChI | InChI=1S/C6H8FNO/c7-4-3-6(8)2-1-5-9/h1-5,9H,8H2/b4-3+,5-1+,6-2+ |
| InChIKey | RVDSUAHUEYADCB-RLPQXWSLSA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|