About chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (PubChem CID 156715308) has the molecular formula C12H17ClN2O2
and a molecular weight of 256.73 g/mol. Its IUPAC name is chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| PubChem CID | 156715308 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| SMILES | CC.CCl.Cc1ccc2cc(C(=O)O)[nH]c2n1 |
| InChI | InChI=1S/C9H8N2O2.C2H6.CH3Cl/c1-5-2-3-6-4-7(9(12)13)11-8(6)10-5;2*1-2/h2-4H,1H3,(H,10,11)(H,12,13);1-2H3;1H3 |
| InChIKey | ITNFQWINMHAMHN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid?
The IUPAC name of chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CID 156715308) is chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid.
What is the SMILES notation for chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid?
The canonical SMILES for chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is CC.CCl.Cc1ccc2cc(C(=O)O)[nH]c2n1.
What is the InChIKey of chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid?
The InChIKey is ITNFQWINMHAMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2.C2H6.CH3Cl/c1-5-2-3-6-4-7(9(12)13)11-8(6)10-5;2*1-2/h2-4H,1H3,(H,10,11)(H,12,13);1-2H3;1H3.
What are the key properties of chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid?
chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid has a molecular weight of 256.73 g/mol, XLogP of 3.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;ethane;6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is sourced from PubChem (CID 156715308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).