C16H21F2N3OSi — CID 156715366
N-(1,1-dimethylsilinan-4-yl)-4,5-difluoro-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide (PubChem CID 156715366) has the molecular formula C16H21F2N3OSi and a molecular weight of 337.45 g/mol. Its IUPAC name is N-(1,1-dimethylsilinan-4-yl)-4,5-difluoro-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-(1,1-dimethylsilinan-4-yl)-4,5-difluoro-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156715366 |
| Molecular Formula | C16H21F2N3OSi |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-(1,1-dimethylsilinan-4-yl)-4,5-difluoro-6-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1nc2[nH]c(C(=O)NC3CC[Si](C)(C)CC3)cc2c(F)c1F |
| InChI | InChI=1S/C16H21F2N3OSi/c1-9-13(17)14(18)11-8-12(21-15(11)19-9)16(22)20-10-4-6-23(2,3)7-5-10/h8,10H,4-7H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | UFSYYMVEWGYGQP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|