About 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane
5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane (PubChem CID 156715440) has the molecular formula C9H14Cl2N2
and a molecular weight of 221.13 g/mol. Its IUPAC name is 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane.
Molecular Properties
| Compound Name | 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane |
| PubChem CID | 156715440 |
| Molecular Formula | C9H14Cl2N2 |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane |
| SMILES | CC.Cc1nc(Cl)c(Cl)c(C)c1N |
| InChI | InChI=1S/C7H8Cl2N2.C2H6/c1-3-5(8)7(9)11-4(2)6(3)10;1-2/h10H2,1-2H3;1-2H3 |
| InChIKey | VRYLCNXKTIBFFK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane?
The IUPAC name of 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane (CID 156715440) is 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane.
What is the SMILES notation for 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane?
The canonical SMILES for 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane is CC.Cc1nc(Cl)c(Cl)c(C)c1N.
What is the InChIKey of 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane?
The InChIKey is VRYLCNXKTIBFFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Cl2N2.C2H6/c1-3-5(8)7(9)11-4(2)6(3)10;1-2/h10H2,1-2H3;1-2H3.
What are the key properties of 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane?
5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane has a molecular weight of 221.13 g/mol, XLogP of 3.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-2,4-dimethylpyridin-3-amine;ethane is sourced from PubChem (CID 156715440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).