About ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane
ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane (PubChem CID 156715531) has the molecular formula C17H22N2O2S
and a molecular weight of 318.44 g/mol. Its IUPAC name is ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane.
Molecular Properties
| Compound Name | ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane |
| PubChem CID | 156715531 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane |
| SMILES | C.C.CCOC(=O)c1cc2sc(-c3ccccc3C)nc2[nH]1 |
| InChI | InChI=1S/C15H14N2O2S.2CH4/c1-3-19-15(18)11-8-12-13(16-11)17-14(20-12)10-7-5-4-6-9(10)2;;/h4-8,16H,3H2,1-2H3;2*1H4 |
| InChIKey | AXNGXPBRMAYJKX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane?
The IUPAC name of ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane (CID 156715531) is ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane.
What is the SMILES notation for ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane?
The canonical SMILES for ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane is C.C.CCOC(=O)c1cc2sc(-c3ccccc3C)nc2[nH]1.
What is the InChIKey of ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane?
The InChIKey is AXNGXPBRMAYJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2S.2CH4/c1-3-19-15(18)11-8-12-13(16-11)17-14(20-12)10-7-5-4-6-9(10)2;;/h4-8,16H,3H2,1-2H3;2*1H4.
What are the key properties of ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane?
ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane has a molecular weight of 318.44 g/mol, XLogP of 5.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-methylphenyl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxylate;methane is sourced from PubChem (CID 156715531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).