About ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol
ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol (PubChem CID 156715584) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol.
Molecular Properties
| Compound Name | ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol |
| PubChem CID | 156715584 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol |
| SMILES | C=C(C)/C=C(\CC)NC(=C)C(=C)O.CC |
| InChI | InChI=1S/C11H17NO.C2H6/c1-6-11(7-8(2)3)12-9(4)10(5)13;1-2/h7,12-13H,2,4-6H2,1,3H3;1-2H3/b11-7+; |
| InChIKey | YDGZSTVKEDSPLW-RVDQCCQOSA-N |
| XLogP | 4.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol?
The IUPAC name of ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol (CID 156715584) is ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol.
What is the SMILES notation for ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol?
The canonical SMILES for ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol is C=C(C)/C=C(\CC)NC(=C)C(=C)O.CC.
What is the InChIKey of ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol?
The InChIKey is YDGZSTVKEDSPLW-RVDQCCQOSA-N. The full InChI is InChI=1S/C11H17NO.C2H6/c1-6-11(7-8(2)3)12-9(4)10(5)13;1-2/h7,12-13H,2,4-6H2,1,3H3;1-2H3/b11-7+;.
What are the key properties of ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol?
ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol has a molecular weight of 209.33 g/mol, XLogP of 4.06, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[[(3E)-5-methylhexa-3,5-dien-3-yl]amino]buta-1,3-dien-2-ol is sourced from PubChem (CID 156715584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).