C26H27AlF4N2O2 — CID 156716221
CID 156716221 (PubChem CID 156716221) has the molecular formula C26H27AlF4N2O2 and a molecular weight of 502.49 g/mol.
| Compound Name | CID 156716221 |
|---|---|
| PubChem CID | 156716221 |
| Molecular Formula | C26H27AlF4N2O2 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc2c(c1)CCCC([Al])=C2c1ccc(O[C@H]2CCN(CCCF)C2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H27F4N2O2.Al/c27-13-3-14-32-15-12-22(17-32)34-21-9-6-18(7-10-21)23-5-2-1-4-19-16-20(8-11-24(19)23)31-25(33)26(28,29)30;/h6-11,16,22H,1-4,12-15,17H2,(H,31,33);/t22-;/m0./s1 |
| InChIKey | SLHMGFAKBGAXAN-FTBISJDPSA-N |
| XLogP | 5.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |