C19H22FN3S — CID 156716502
1-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-N-[(E)-2-fluoroprop-1-enyl]butan-1-imine (PubChem CID 156716502) has the molecular formula C19H22FN3S and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-N-[(E)-2-fluoroprop-1-enyl]butan-1-imine.
| Compound Name | 1-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-N-[(E)-2-fluoroprop-1-enyl]butan-1-imine |
|---|---|
| PubChem CID | 156716502 |
| Molecular Formula | C19H22FN3S |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-N-[(E)-2-fluoroprop-1-enyl]butan-1-imine |
| SMILES | C=C/C=C\c1c(-c2csc(/C(CCC)=N/C=C(\C)F)n2)c[nH]c1C |
| InChI | InChI=1S/C19H22FN3S/c1-5-7-9-15-14(4)21-11-16(15)18-12-24-19(23-18)17(8-6-2)22-10-13(3)20/h5,7,9-12,21H,1,6,8H2,2-4H3/b9-7-,13-10+,22-17+ |
| InChIKey | OUNCNRYZKFPVSK-HDYNWDCMSA-N |
| XLogP | 6.07 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|