C22H29N3OS — CID 156716560
N-[(Z)-1-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-2-(cyclopropylmethoxy)ethenyl]methanimine;propane (PubChem CID 156716560) has the molecular formula C22H29N3OS and a molecular weight of 383.56 g/mol. Its IUPAC name is N-[(Z)-1-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-2-(cyclopropylmethoxy)ethenyl]methanimine;propane.
| Compound Name | N-[(Z)-1-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-2-(cyclopropylmethoxy)ethenyl]methanimine;propane |
|---|---|
| PubChem CID | 156716560 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[(Z)-1-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-2-(cyclopropylmethoxy)ethenyl]methanimine;propane |
| SMILES | C=C/C=C\c1c(-c2csc(/C(=C/OCC3CC3)N=C)n2)c[nH]c1C.CCC |
| InChI | InChI=1S/C19H21N3OS.C3H8/c1-4-5-6-15-13(2)21-9-16(15)18-12-24-19(22-18)17(20-3)11-23-10-14-7-8-14;1-3-2/h4-6,9,11-12,14,21H,1,3,7-8,10H2,2H3;3H2,1-2H3/b6-5-,17-11-; |
| InChIKey | NWPRJRDNLJDTRF-JAAWGLRQSA-N |
| XLogP | 6.49 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|