C32H45F2N3O2S — CID 156716616
5-acetyl-3-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;3-ethyl-2,2-difluorooctane;propane (PubChem CID 156716616) has the molecular formula C32H45F2N3O2S and a molecular weight of 573.79 g/mol. Its IUPAC name is 5-acetyl-3-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;3-ethyl-2,2-difluorooctane;propane.
| Compound Name | 5-acetyl-3-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;3-ethyl-2,2-difluorooctane;propane |
|---|---|
| PubChem CID | 156716616 |
| Molecular Formula | C32H45F2N3O2S |
| Molecular Weight | 573.79 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | 5-acetyl-3-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;3-ethyl-2,2-difluorooctane;propane |
| SMILES | C=C/C=C\c1c(-c2csc(-c3cc(C(C)=O)c[nH]c3=O)n2)c[nH]c1C.CCC.CCCCCC(CC)C(C)(F)F |
| InChI | InChI=1S/C19H17N3O2S.C10H20F2.C3H8/c1-4-5-6-14-11(2)20-9-16(14)17-10-25-19(22-17)15-7-13(12(3)23)8-21-18(15)24;1-4-6-7-8-9(5-2)10(3,11)12;1-3-2/h4-10,20H,1H2,2-3H3,(H,21,24);9H,4-8H2,1-3H3;3H2,1-2H3/b6-5-;; |
| InChIKey | CGYVJNBUMZEBLB-XNOMRPDFSA-N |
| XLogP | 9.87 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.79 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|