C16H25F3N2O3 — CID 156716619
ethane;N-[(1E)-4-methyl-2-[2-(2,2,2-trifluoroethyl)morpholine-4-carbonyl]penta-1,3-dienyl]formamide (PubChem CID 156716619) has the molecular formula C16H25F3N2O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is ethane;N-[(1E)-4-methyl-2-[2-(2,2,2-trifluoroethyl)morpholine-4-carbonyl]penta-1,3-dienyl]formamide.
| Compound Name | ethane;N-[(1E)-4-methyl-2-[2-(2,2,2-trifluoroethyl)morpholine-4-carbonyl]penta-1,3-dienyl]formamide |
|---|---|
| PubChem CID | 156716619 |
| Molecular Formula | C16H25F3N2O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | ethane;N-[(1E)-4-methyl-2-[2-(2,2,2-trifluoroethyl)morpholine-4-carbonyl]penta-1,3-dienyl]formamide |
| SMILES | CC.CC(C)=C/C(=C\NC=O)C(=O)N1CCOC(CC(F)(F)F)C1 |
| InChI | InChI=1S/C14H19F3N2O3.C2H6/c1-10(2)5-11(7-18-9-20)13(21)19-3-4-22-12(8-19)6-14(15,16)17;1-2/h5,7,9,12H,3-4,6,8H2,1-2H3,(H,18,20);1-2H3/b11-7+; |
| InChIKey | MCQKCXSJKJQGIH-RVDQCCQOSA-N |
| XLogP | 2.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|