C21H21F3N4O2S — CID 156716624
(E,2E)-4-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-2-(formamidomethylidene)-N-(2,2,2-trifluoroethyl)pent-3-enamide (PubChem CID 156716624) has the molecular formula C21H21F3N4O2S and a molecular weight of 450.49 g/mol. Its IUPAC name is (E,2E)-4-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-2-(formamidomethylidene)-N-(2,2,2-trifluoroethyl)pent-3-enamide.
| Compound Name | (E,2E)-4-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-2-(formamidomethylidene)-N-(2,2,2-trifluoroethyl)pent-3-enamide |
|---|---|
| PubChem CID | 156716624 |
| Molecular Formula | C21H21F3N4O2S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (E,2E)-4-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-2-(formamidomethylidene)-N-(2,2,2-trifluoroethyl)pent-3-enamide |
| SMILES | C=C/C=C\c1c(-c2csc(/C(C)=C/C(=C\NC=O)C(=O)NCC(F)(F)F)n2)c[nH]c1C |
| InChI | InChI=1S/C21H21F3N4O2S/c1-4-5-6-16-14(3)26-9-17(16)18-10-31-20(28-18)13(2)7-15(8-25-12-29)19(30)27-11-21(22,23)24/h4-10,12,26H,1,11H2,2-3H3,(H,25,29)(H,27,30)/b6-5-,13-7+,15-8+ |
| InChIKey | TZEZVOQNTSFIJC-LSGVSCKPSA-N |
| XLogP | 4.36 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|