C17H14FN3OS — CID 156716708
3-[4-[4-[(1E)-2-fluorobuta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one (PubChem CID 156716708) has the molecular formula C17H14FN3OS and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-[4-[4-[(1E)-2-fluorobuta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one.
| Compound Name | 3-[4-[4-[(1E)-2-fluorobuta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 156716708 |
| Molecular Formula | C17H14FN3OS |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-[4-[4-[(1E)-2-fluorobuta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one |
| SMILES | C=C/C(F)=C\c1c(-c2csc(-c3ccc[nH]c3=O)n2)c[nH]c1C |
| InChI | InChI=1S/C17H14FN3OS/c1-3-11(18)7-13-10(2)20-8-14(13)15-9-23-17(21-15)12-5-4-6-19-16(12)22/h3-9,20H,1H2,2H3,(H,19,22)/b11-7+ |
| InChIKey | CGFBOQUJJLVGIJ-YRNVUSSQSA-N |
| XLogP | 4.30 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|