C21H18N4S — CID 156716797
4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-2-(2-phenyl-1H-imidazol-5-yl)-1,3-thiazole (PubChem CID 156716797) has the molecular formula C21H18N4S and a molecular weight of 358.47 g/mol. Its IUPAC name is 4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-2-(2-phenyl-1H-imidazol-5-yl)-1,3-thiazole.
| Compound Name | 4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-2-(2-phenyl-1H-imidazol-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 156716797 |
| Molecular Formula | C21H18N4S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-2-(2-phenyl-1H-imidazol-5-yl)-1,3-thiazole |
| SMILES | C=C/C=C\c1c(-c2csc(-c3cnc(-c4ccccc4)[nH]3)n2)c[nH]c1C |
| InChI | InChI=1S/C21H18N4S/c1-3-4-10-16-14(2)22-11-17(16)19-13-26-21(25-19)18-12-23-20(24-18)15-8-6-5-7-9-15/h3-13,22H,1H2,2H3,(H,23,24)/b10-4- |
| InChIKey | CQAWLARYTBJISB-WMZJFQQLSA-N |
| XLogP | 5.70 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|