C12H19F3N2O2 — CID 156716803
ethane;(2E)-2-(formamidomethylidene)-4-methyl-N-(2,2,2-trifluoroethyl)pent-3-enamide (PubChem CID 156716803) has the molecular formula C12H19F3N2O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is ethane;(2E)-2-(formamidomethylidene)-4-methyl-N-(2,2,2-trifluoroethyl)pent-3-enamide.
| Compound Name | ethane;(2E)-2-(formamidomethylidene)-4-methyl-N-(2,2,2-trifluoroethyl)pent-3-enamide |
|---|---|
| PubChem CID | 156716803 |
| Molecular Formula | C12H19F3N2O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | ethane;(2E)-2-(formamidomethylidene)-4-methyl-N-(2,2,2-trifluoroethyl)pent-3-enamide |
| SMILES | CC.CC(C)=C/C(=C\NC=O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O2.C2H6/c1-7(2)3-8(4-14-6-16)9(17)15-5-10(11,12)13;1-2/h3-4,6H,5H2,1-2H3,(H,14,16)(H,15,17);1-2H3/b8-4+; |
| InChIKey | NVRUJTVBAUDZKA-ZFXMFRGYSA-N |
| XLogP | 2.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|