C24H29N5O4SSi — CID 156716919
N-methoxy-N-methyl-6-oxo-5-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxamide (PubChem CID 156716919) has the molecular formula C24H29N5O4SSi and a molecular weight of 511.68 g/mol. Its IUPAC name is N-methoxy-N-methyl-6-oxo-5-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxamide.
| Compound Name | N-methoxy-N-methyl-6-oxo-5-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156716919 |
| Molecular Formula | C24H29N5O4SSi |
| Molecular Weight | 511.68 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | N-methoxy-N-methyl-6-oxo-5-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxamide |
| SMILES | CON(C)C(=O)c1cc(-c2nc(-c3c[nH]c4ncccc34)cs2)c(=O)n(COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C24H29N5O4SSi/c1-28(32-2)23(30)16-11-18(24(31)29(13-16)15-33-9-10-35(3,4)5)22-27-20(14-34-22)19-12-26-21-17(19)7-6-8-25-21/h6-8,11-14H,9-10,15H2,1-5H3,(H,25,26) |
| InChIKey | FAICBQMHABXANF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|