C31H42F3N3O3S — CID 156716936
5-acetyl-3-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;3-butoxy-1,1,1-trifluoropentane;propane (PubChem CID 156716936) has the molecular formula C31H42F3N3O3S and a molecular weight of 593.76 g/mol. Its IUPAC name is 5-acetyl-3-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;3-butoxy-1,1,1-trifluoropentane;propane.
| Compound Name | 5-acetyl-3-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;3-butoxy-1,1,1-trifluoropentane;propane |
|---|---|
| PubChem CID | 156716936 |
| Molecular Formula | C31H42F3N3O3S |
| Molecular Weight | 593.76 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | 5-acetyl-3-[4-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]-1H-pyridin-2-one;3-butoxy-1,1,1-trifluoropentane;propane |
| SMILES | C=C/C=C\c1c(-c2csc(-c3cc(C(C)=O)c[nH]c3=O)n2)c[nH]c1C.CCC.CCCCOC(CC)CC(F)(F)F |
| InChI | InChI=1S/C19H17N3O2S.C9H17F3O.C3H8/c1-4-5-6-14-11(2)20-9-16(14)17-10-25-19(22-17)15-7-13(12(3)23)8-21-18(15)24;1-3-5-6-13-8(4-2)7-9(10,11)12;1-3-2/h4-10,20H,1H2,2-3H3,(H,21,24);8H,3-7H2,1-2H3;3H2,1-2H3/b6-5-;; |
| InChIKey | GSMDGPFMTJNQFM-XNOMRPDFSA-N |
| XLogP | 9.15 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.76 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|