C28H24BF4N3O3 — CID 156717430
CID 156717430 (PubChem CID 156717430) has the molecular formula C28H24BF4N3O3 and a molecular weight of 537.32 g/mol.
| Compound Name | CID 156717430 |
|---|---|
| PubChem CID | 156717430 |
| Molecular Formula | C28H24BF4N3O3 |
| Molecular Weight | 537.32 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(C(F)(F)F)c1Cn1c(C)c(-c2cccc(OC)c2F)c(=O)n(CC(N)c2ccccc2)c1=O |
| InChI | InChI=1S/C28H24BF4N3O3/c1-16-24(18-10-6-13-23(39-2)25(18)30)26(37)36(15-22(34)17-8-4-3-5-9-17)27(38)35(16)14-19-20(28(31,32)33)11-7-12-21(19)29/h3-13,22H,14-15,34H2,1-2H3 |
| InChIKey | KFBWJUPQSAPHFY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|