C10H17F5N2 — CID 156717501
(Z)-4-(2,2-difluoropropylimino)-1,1,1-trifluoropent-2-en-2-amine;ethane (PubChem CID 156717501) has the molecular formula C10H17F5N2 and a molecular weight of 260.25 g/mol. Its IUPAC name is (Z)-4-(2,2-difluoropropylimino)-1,1,1-trifluoropent-2-en-2-amine;ethane.
| Compound Name | (Z)-4-(2,2-difluoropropylimino)-1,1,1-trifluoropent-2-en-2-amine;ethane |
|---|---|
| PubChem CID | 156717501 |
| Molecular Formula | C10H17F5N2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (Z)-4-(2,2-difluoropropylimino)-1,1,1-trifluoropent-2-en-2-amine;ethane |
| SMILES | CC.CC(/C=C(\N)C(F)(F)F)=N\CC(C)(F)F |
| InChI | InChI=1S/C8H11F5N2.C2H6/c1-5(15-4-7(2,9)10)3-6(14)8(11,12)13;1-2/h3H,4,14H2,1-2H3;1-2H3/b6-3-,15-5+; |
| InChIKey | SYKFTIKWSOFOJT-WYLCTCOKSA-N |
| XLogP | 3.53 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|