C26H27N3O3 — CID 156717583
3-amino-N-[8-[(4-methoxybenzoyl)-methylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]benzamide (PubChem CID 156717583) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-amino-N-[8-[(4-methoxybenzoyl)-methylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]benzamide.
| Compound Name | 3-amino-N-[8-[(4-methoxybenzoyl)-methylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 156717583 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 3-amino-N-[8-[(4-methoxybenzoyl)-methylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)N(C)C2CCCc3ccc(NC(=O)c4cccc(N)c4)cc32)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-29(26(31)18-10-13-22(32-2)14-11-18)24-8-4-5-17-9-12-21(16-23(17)24)28-25(30)19-6-3-7-20(27)15-19/h3,6-7,9-16,24H,4-5,8,27H2,1-2H3,(H,28,30) |
| InChIKey | ZSHFAHXHNRRBRI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|