C12H22N6 — CID 156717760
N-butyl-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]-1,3,5-triazin-2-amine (PubChem CID 156717760) has the molecular formula C12H22N6 and a molecular weight of 250.35 g/mol. Its IUPAC name is N-butyl-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 156717760 |
| Molecular Formula | C12H22N6 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | N-butyl-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]-1,3,5-triazin-2-amine |
| SMILES | CCCCNc1ncnc(N2CC[C@H](NC)C2)n1 |
| InChI | InChI=1S/C12H22N6/c1-3-4-6-14-11-15-9-16-12(17-11)18-7-5-10(8-18)13-2/h9-10,13H,3-8H2,1-2H3,(H,14,15,16,17)/t10-/m0/s1 |
| InChIKey | YLJQICHTWGDFCM-JTQLQIEISA-N |
| XLogP | 0.88 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|