C16H24BrF2N3O2Si — CID 156717951
3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxy-3,3-difluoropropan-1-amine (PubChem CID 156717951) has the molecular formula C16H24BrF2N3O2Si and a molecular weight of 436.37 g/mol. Its IUPAC name is 3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxy-3,3-difluoropropan-1-amine.
| Compound Name | 3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxy-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 156717951 |
| Molecular Formula | C16H24BrF2N3O2Si |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxy-3,3-difluoropropan-1-amine |
| SMILES | C[Si](C)(C)CCOCn1ccc2cc(Br)c(OC(F)(F)CCN)nc21 |
| InChI | InChI=1S/C16H24BrF2N3O2Si/c1-25(2,3)9-8-23-11-22-7-4-12-10-13(17)15(21-14(12)22)24-16(18,19)5-6-20/h4,7,10H,5-6,8-9,11,20H2,1-3H3 |
| InChIKey | ZBAUXJQQUZGOSX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|