C25H27FIN3O3 — CID 156718014
4-(4-fluorophenyl)-6-[2-[1-(3-methoxyphenyl)but-2-en-2-ylamino]ethyl]-1-oxo-2H-[1,3]iodoxolo[4,5-c]pyridin-1-amine (PubChem CID 156718014) has the molecular formula C25H27FIN3O3 and a molecular weight of 563.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-6-[2-[1-(3-methoxyphenyl)but-2-en-2-ylamino]ethyl]-1-oxo-2H-[1,3]iodoxolo[4,5-c]pyridin-1-amine.
| Compound Name | 4-(4-fluorophenyl)-6-[2-[1-(3-methoxyphenyl)but-2-en-2-ylamino]ethyl]-1-oxo-2H-[1,3]iodoxolo[4,5-c]pyridin-1-amine |
|---|---|
| PubChem CID | 156718014 |
| Molecular Formula | C25H27FIN3O3 |
| Molecular Weight | 563.41 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | 4-(4-fluorophenyl)-6-[2-[1-(3-methoxyphenyl)but-2-en-2-ylamino]ethyl]-1-oxo-2H-[1,3]iodoxolo[4,5-c]pyridin-1-amine |
| SMILES | CC=C(Cc1cccc(OC)c1)NCCc1cc2c(c(-c3ccc(F)cc3)n1)OCI2(N)=O |
| InChI | InChI=1S/C25H27FIN3O3/c1-3-20(13-17-5-4-6-22(14-17)32-2)29-12-11-21-15-23-25(33-16-27(23,28)31)24(30-21)18-7-9-19(26)10-8-18/h3-10,14-15,29H,11-13,16H2,1-2H3,(H2,28,31) |
| InChIKey | BZXNQAVBLFLZNR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|