About 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane
3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane (PubChem CID 156718025) has the molecular formula C17H23NO2
and a molecular weight of 273.38 g/mol. Its IUPAC name is 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane.
Molecular Properties
| Compound Name | 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane |
| PubChem CID | 156718025 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane |
| SMILES | CC1CC1.CO.Cc1cnc2c(C)cc(C=O)cc2c1 |
| InChI | InChI=1S/C12H11NO.C4H8.CH4O/c1-8-3-11-5-10(7-14)4-9(2)12(11)13-6-8;1-4-2-3-4;1-2/h3-7H,1-2H3;4H,2-3H2,1H3;2H,1H3 |
| InChIKey | YEPMPBMCJBLYCY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane?
The IUPAC name of 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane (CID 156718025) is 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane.
What is the SMILES notation for 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane?
The canonical SMILES for 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane is CC1CC1.CO.Cc1cnc2c(C)cc(C=O)cc2c1.
What is the InChIKey of 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane?
The InChIKey is YEPMPBMCJBLYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO.C4H8.CH4O/c1-8-3-11-5-10(7-14)4-9(2)12(11)13-6-8;1-4-2-3-4;1-2/h3-7H,1-2H3;4H,2-3H2,1H3;2H,1H3.
What are the key properties of 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane?
3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane has a molecular weight of 273.38 g/mol, XLogP of 3.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethylquinoline-6-carbaldehyde;methanol;methylcyclopropane is sourced from PubChem (CID 156718025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).