C15H16FN3O2P+ — CID 156718164
2-[4-(4-fluorophenyl)spiro[2H-[1,3]oxaphospholo[5,4-c]pyridin-1-ium-1,3'-oxazaphosphiridin-3-ium]-6-yl]-N-methylethanamine (PubChem CID 156718164) has the molecular formula C15H16FN3O2P+ and a molecular weight of 320.28 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)spiro[2H-[1,3]oxaphospholo[5,4-c]pyridin-1-ium-1,3'-oxazaphosphiridin-3-ium]-6-yl]-N-methylethanamine.
| Compound Name | 2-[4-(4-fluorophenyl)spiro[2H-[1,3]oxaphospholo[5,4-c]pyridin-1-ium-1,3'-oxazaphosphiridin-3-ium]-6-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 156718164 |
| Molecular Formula | C15H16FN3O2P+ |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-[4-(4-fluorophenyl)spiro[2H-[1,3]oxaphospholo[5,4-c]pyridin-1-ium-1,3'-oxazaphosphiridin-3-ium]-6-yl]-N-methylethanamine |
| SMILES | CNCCc1cc2c(c(-c3ccc(F)cc3)n1)OC[P+]21NO1 |
| InChI | InChI=1S/C15H16FN3O2P/c1-17-7-6-12-8-13-15(20-9-22(13)19-21-22)14(18-12)10-2-4-11(16)5-3-10/h2-5,8,17,19H,6-7,9H2,1H3/q+1 |
| InChIKey | SIPFMOLHOOTSNU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|