C34H27F4N5O6 — CID 156719443
4-amino-N-[[5-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]furan-2-yl]methyl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 156719443) has the molecular formula C34H27F4N5O6 and a molecular weight of 677.61 g/mol. Its IUPAC name is 4-amino-N-[[5-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]furan-2-yl]methyl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | 4-amino-N-[[5-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]furan-2-yl]methyl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 156719443 |
| Molecular Formula | C34H27F4N5O6 |
| Molecular Weight | 677.61 g/mol |
| Exact Mass | 677.19 |
| IUPAC Name | 4-amino-N-[[5-[3-[2-(4-benzoylpiperazin-1-yl)-2-oxoacetyl]-4-methoxy-1H-indol-7-yl]furan-2-yl]methyl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | COc1ccc(-c2ccc(CNC(=O)c3c(F)c(F)c(N)c(F)c3F)o2)c2[nH]cc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C34H27F4N5O6/c1-48-22-10-8-19(21-9-7-18(49-21)15-41-32(45)24-25(35)27(37)29(39)28(38)26(24)36)30-23(22)20(16-40-30)31(44)34(47)43-13-11-42(12-14-43)33(46)17-5-3-2-4-6-17/h2-10,16,40H,11-15,39H2,1H3,(H,41,45) |
| InChIKey | DFPNTZDMVZDFJL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 150.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|