About 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine
2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine (PubChem CID 156719464) has the molecular formula C23H23FN6S
and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine.
Molecular Properties
| Compound Name | 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine |
| PubChem CID | 156719464 |
| Molecular Formula | C23H23FN6S |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine |
| SMILES | Nc1cc2nc(SC3CCC(Nc4ccc(-n5cccn5)cc4F)CC3)ccc2cn1 |
| InChI | InChI=1S/C23H23FN6S/c24-19-12-17(30-11-1-10-27-30)5-8-20(19)28-16-3-6-18(7-4-16)31-23-9-2-15-14-26-22(25)13-21(15)29-23/h1-2,5,8-14,16,18,28H,3-4,6-7H2,(H2,25,26) |
| InChIKey | SHHIETJYWFQWPV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine?
The IUPAC name of 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine (CID 156719464) is 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine.
What is the SMILES notation for 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine?
The canonical SMILES for 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine is Nc1cc2nc(SC3CCC(Nc4ccc(-n5cccn5)cc4F)CC3)ccc2cn1.
What is the InChIKey of 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine?
The InChIKey is SHHIETJYWFQWPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN6S/c24-19-12-17(30-11-1-10-27-30)5-8-20(19)28-16-3-6-18(7-4-16)31-23-9-2-15-14-26-22(25)13-21(15)29-23/h1-2,5,8-14,16,18,28H,3-4,6-7H2,(H2,25,26).
What are the key properties of 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine?
2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine has a molecular weight of 434.54 g/mol, XLogP of 5.05, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-fluoro-4-pyrazol-1-ylanilino)cyclohexyl]sulfanyl-1,6-naphthyridin-7-amine is sourced from PubChem (CID 156719464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).