About 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol
1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol (PubChem CID 156719708) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol.
Molecular Properties
| Compound Name | 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol |
| PubChem CID | 156719708 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol |
| SMILES | OC1CCC1.OC1CCN(CC2CNC2)CC1 |
| InChI | InChI=1S/C9H18N2O.C4H8O/c12-9-1-3-11(4-2-9)7-8-5-10-6-8;5-4-2-1-3-4/h8-10,12H,1-7H2;4-5H,1-3H2 |
| InChIKey | SILVVIXLDKCJJW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol?
The IUPAC name of 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol (CID 156719708) is 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol.
What is the SMILES notation for 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol?
The canonical SMILES for 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol is OC1CCC1.OC1CCN(CC2CNC2)CC1.
What is the InChIKey of 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol?
The InChIKey is SILVVIXLDKCJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C4H8O/c12-9-1-3-11(4-2-9)7-8-5-10-6-8;5-4-2-1-3-4/h8-10,12H,1-7H2;4-5H,1-3H2.
What are the key properties of 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol?
1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol has a molecular weight of 242.36 g/mol, XLogP of 0.19, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-ylmethyl)piperidin-4-ol;cyclobutanol is sourced from PubChem (CID 156719708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).