C15H35N5O — CID 156719788
N-ethyl-N'-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,4-diamine;N-methylformamide (PubChem CID 156719788) has the molecular formula C15H35N5O and a molecular weight of 301.48 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,4-diamine;N-methylformamide.
| Compound Name | N-ethyl-N'-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,4-diamine;N-methylformamide |
|---|---|
| PubChem CID | 156719788 |
| Molecular Formula | C15H35N5O |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | N-ethyl-N'-[2-(4-methylpiperazin-1-yl)ethyl]butane-1,4-diamine;N-methylformamide |
| SMILES | CCNCCCCNCCN1CCN(C)CC1.CNC=O |
| InChI | InChI=1S/C13H30N4.C2H5NO/c1-3-14-6-4-5-7-15-8-9-17-12-10-16(2)11-13-17;1-3-2-4/h14-15H,3-13H2,1-2H3;2H,1H3,(H,3,4) |
| InChIKey | RACMNKNRZAOZMB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|