About O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine
O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine (PubChem CID 156719894) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine |
| PubChem CID | 156719894 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine |
| SMILES | CN1CCC2(CC1)CCN(CC1CC(ON)C1)CC2 |
| InChI | InChI=1S/C15H29N3O/c1-17-6-2-15(3-7-17)4-8-18(9-5-15)12-13-10-14(11-13)19-16/h13-14H,2-12,16H2,1H3 |
| InChIKey | URMJIGNVDBPJJL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine?
The IUPAC name of O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine (CID 156719894) is O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine.
What is the SMILES notation for O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine?
The canonical SMILES for O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine is CN1CCC2(CC1)CCN(CC1CC(ON)C1)CC2.
What is the InChIKey of O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine?
The InChIKey is URMJIGNVDBPJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O/c1-17-6-2-15(3-7-17)4-8-18(9-5-15)12-13-10-14(11-13)19-16/h13-14H,2-12,16H2,1H3.
What are the key properties of O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine?
O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine has a molecular weight of 267.42 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[3-[(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)methyl]cyclobutyl]hydroxylamine is sourced from PubChem (CID 156719894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).