C23H44N2O2 — CID 156719927
ethane;[4-(2-methoxyethyl)piperidin-1-yl]-[3-(4-propylpiperidin-1-yl)cyclobutyl]methanone (PubChem CID 156719927) has the molecular formula C23H44N2O2 and a molecular weight of 380.62 g/mol. Its IUPAC name is ethane;[4-(2-methoxyethyl)piperidin-1-yl]-[3-(4-propylpiperidin-1-yl)cyclobutyl]methanone.
| Compound Name | ethane;[4-(2-methoxyethyl)piperidin-1-yl]-[3-(4-propylpiperidin-1-yl)cyclobutyl]methanone |
|---|---|
| PubChem CID | 156719927 |
| Molecular Formula | C23H44N2O2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | ethane;[4-(2-methoxyethyl)piperidin-1-yl]-[3-(4-propylpiperidin-1-yl)cyclobutyl]methanone |
| SMILES | CC.CCCC1CCN(C2CC(C(=O)N3CCC(CCOC)CC3)C2)CC1 |
| InChI | InChI=1S/C21H38N2O2.C2H6/c1-3-4-17-5-10-22(11-6-17)20-15-19(16-20)21(24)23-12-7-18(8-13-23)9-14-25-2;1-2/h17-20H,3-16H2,1-2H3;1-2H3 |
| InChIKey | LXXCKMDLODSLNI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |